Introduction:Basic information about CAS 5538-57-8|3-hydroxy-7-methoxy-N-(o-tolyl)naphthalene-2-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-hydroxy-7-methoxy-N-(o-tolyl)naphthalene-2-carboxamide |
|---|
| CAS Number | 5538-57-8 | Molecular Weight | 307.34300 |
|---|
| Density | 1.274g/cm3 | Boiling Point | 433.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H17NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.2ºC |
|---|
Names
| Name | 3-hydroxy-7-methoxy-N-(o-tolyl)naphthalene-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.274g/cm3 |
|---|
| Boiling Point | 433.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H17NO3 |
|---|
| Molecular Weight | 307.34300 |
|---|
| Flash Point | 216.2ºC |
|---|
| Exact Mass | 307.12100 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 4.18770 |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | ISYIACJPZHHKAB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2cc(O)c(C(=O)Nc3ccccc3C)cc2c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-hydroxy-7-methoxy-[2]naphthoic acid o-toluidide |
| 2'-methyl-3-hydroxy-7-methoxy-2-naphthanilide |
| 3-Hydroxy-7-methoxy-N-(2-methylphenyl)-2-naphthamide |
| Naphtanilide CB |
| Naphtanilide CB Supra |
| 2-Hydroxy-6-methoxy-N-(o-tolyl)-3-naphthalenecarboxamide |
| 3-Hydroxy-7-methoxy-[2]naphthoesaeure-o-toluidid |
| C.I.Azoic Coupling Component 111 |
| 2-NaphthalenecarboxaMide,3-hydroxy-7-Methoxy-N-(2-Methylphenyl) |