Introduction：Basic information about CAS 85-09-6|2-aminonaphthalene-1-methylsulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-aminonaphthalene-1-methylsulphonic acid |
|---|
| CAS Number | 85-09-6 | Molecular Weight | 239.29100 |
|---|
| Density | 1.476g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C11H13NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2-aminonaphthalen-1-yl)methanesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.476g/cm3 |
|---|
| Molecular Formula | C11H13NO3S |
|---|
| Molecular Weight | 239.29100 |
|---|
| Exact Mass | 239.06200 |
|---|
| PSA | 88.77000 |
|---|
| LogP | 3.58800 |
|---|
| Index of Refraction | 1.711 |
|---|
| InChIKey | HAODCXVRFDVUMY-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2ccccc2c1CS(=O)(=O)O |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| (2-amino-[1]naphthyl)-methanesulfonic acid |
| 2-aminonaphthalene-1-methylsulfonic acid |
| 2-Aminonaphthalene-1-methylsulphonic acid |
| EINECS 201-587-8 |
| (2-Amino-[1]naphthyl)-methansulfonsaeure |
| 2-Amino-1-naphthalenemethanesulfonicacid |
| 1-Naphthalenemethanesulfonic acid,2-amino |
| 2-Amino-1-methyl-naphthalin-sulfonsaeure--(11) |
