Introduction：Basic information about CAS 2065-66-9|Methyltriphenylphosphonium iodide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyltriphenylphosphonium iodide |
|---|
| CAS Number | 2065-66-9 | Molecular Weight | 404.224 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H18IP | Melting Point | 183-185 °C(lit.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | methyl(triphenyl)phosphanium,iodide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 183-185 °C(lit.) |
|---|
| Molecular Formula | C19H18IP |
|---|
| Molecular Weight | 404.224 |
|---|
| Exact Mass | 404.019073 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 0.61430 |
|---|
| InChIKey | JNMIXMFEVJHFNY-UHFFFAOYSA-M |
|---|
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
|---|
| Water Solubility | SOLUBLE |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | R25;R36/37/38 |
|---|
| Safety Phrases | S26-S36-S45-S37/39-S28A |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Methyltriphenylphosphonium iodide |
| MFCD00066175 |
| Triphenylmethylphosphonium iodide |
| MeP(1+)PPh3I(1-) |
| methyltriphenyl-phosphonium iodide |
| Triphenylmethylphosphinium iodide |
| Phosphonium, methyltriphenyl-, iodide (1:1) |
| EINECS 218-178-5 |
| [Ph3PCH3](1+)I(1-) |
| Methyl(triphenyl)phosphonium iodide |
| triphenyl-methyl-phosphonium iodide |
| methyl(triphenyl)phosphanium iodide |
| Triphenylmethylphosphine iodide |
| Methyltriphenylphosphoniumiodide |
