Introduction：Basic information about CAS 1530-32-1|Ethyl(triphenyl)phosphonium bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl(triphenyl)phosphonium bromide |
|---|
| CAS Number | 1530-32-1 | Molecular Weight | 371.251 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H20BrP | Melting Point | 203-205 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 200 °C |
|---|
| Symbol |
GHS06, GHS09 | Signal Word | Danger |
|---|
Names
| Name | Ethyltriphenylphosphonium bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 203-205 °C(lit.) |
|---|
| Molecular Formula | C20H20BrP |
|---|
| Molecular Weight | 371.251 |
|---|
| Flash Point | 200 °C |
|---|
| Exact Mass | 370.048584 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 1.00440 |
|---|
| InChIKey | JHYNXXDQQHTCHJ-UHFFFAOYSA-M |
|---|
| SMILES | CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|---|
| Water Solubility | 120 g/L (23 ºC) |
|---|
Safety Information
| Symbol |
GHS06, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H411 |
|---|
| Precautionary Statements | P273-P301 + P310 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R21/22;R36/37/38;R51/53 |
|---|
| Safety Phrases | S61-S36/37/39-S26 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| WGK Germany | 2 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 29310095 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| UNII-R85V84UL5V |
| ethyltriphenyl phosphonium bromide |
| Ethyltriphenylphosphonium bromide |
| ethyltriphenyl-phosphonium bromide |
| triphenylethylphosphonium bromide |
| Phosphonium, ethyltriphenyl-, bromide (1:1) |
| (Ethyl)-triphenylphosphonium bromide |
| EINECS 216-223-3 |
| phosphonium, ethyltriphenyl-, bromide |
| ethyl(triphenyl)phosphanium,bromide |
| Ethyl triphenylphosphonium Bromide |
| MFCD00011838 |
| Ethyl triphenyl phosphonium bromide |
