Introduction：Basic information about CAS 54660-12-7|IFLAB-BB F2124-0138, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | IFLAB-BB F2124-0138 |
|---|
| CAS Number | 54660-12-7 | Molecular Weight | 202.59800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H7ClN4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-chloro-N,N-dimethyl-5-nitropyrimidin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C6H7ClN4O2 |
|---|
| Molecular Weight | 202.59800 |
|---|
| Exact Mass | 202.02600 |
|---|
| PSA | 74.84000 |
|---|
| LogP | 1.62740 |
|---|
| InChIKey | RIZZEVDOTSTXCG-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ncnc(Cl)c1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-chloro-6-dimethylamino-5-nitropyrimidine |
| 4-dimethylamino-5-nitro-6-chloropyrimidine |
| 4-dimethylamino-6-chloro-5-nitropyrimidine |
| (6-Chlor-5-nitro-pyrimidin-4-yl)-dimethyl-amin |
| (6-chloro-5-nitro-pyrimidin-4-yl)-dimethyl-amine |
| 4-chloro-6-(N,N-dimethylamino)-5-nitropyrimidine |
| 6-chloro-4-dimethylamino-5-nitropyrimidine |
