Introduction：Basic information about CAS 2043-55-2|1H,1H,2H,2H-Perfluorohexyl iodide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H,1H,2H,2H-Perfluorohexyl iodide |
|---|
| CAS Number | 2043-55-2 | Molecular Weight | 373.98600 |
|---|
| Density | 1.94 g/mL at 20 °C(lit.) | Boiling Point | 138 °C |
|---|
| Molecular Formula | C6H4F9I | Melting Point | -25°C |
|---|
| MSDS | ChineseUSA | Flash Point | 138-140°C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1H,1H,2H,2H-Perfluorohexyl iodide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.94 g/mL at 20 °C(lit.) |
|---|
| Boiling Point | 138 °C |
|---|
| Melting Point | -25°C |
|---|
| Molecular Formula | C6H4F9I |
|---|
| Molecular Weight | 373.98600 |
|---|
| Flash Point | 138-140°C |
|---|
| Exact Mass | 373.92100 |
|---|
| LogP | 4.27970 |
|---|
| Vapour Pressure | 4.88mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.370 |
|---|
| InChIKey | CXHFIVFPHDGZIS-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1H,1H,2H,2H-Perfluorohexyl Iodide |
| EINECS 218-055-6 |
| 3,3,4,4,5,5,6,6,6-fluorohexyl iodide |
| 1H,1H,2H,2H-Perfluorohexyliodide |
| 1H,1H,2H,2H-Nonafluorohexyl Iodide |
| 2-(Nonafluorobutyl)ethyl Iodide |
| 1-IODO-1H,1H,2H,2H-PERFLUOROHEXANE |
| MFCD00039409 |
| 3,3,4,4,5,5,6,6,6-nonafluorohexyl iodide |
| 1-IODO-1H,1H,2H,2H-NONAFLUOROHEXANE |
| 1-iodo-3,3,4,4,5,5,6,6,6-nonafluorohexane |
| 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodohexane |
| 1H,1H,2H,2H-perfluoro-1-iodohexane |
| Nonafluoro-6-iodohexane |
