Introduction：Basic information about CAS 15922-01-7|potassium,4-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | potassium,4-nitrobenzoate |
|---|
| CAS Number | 15922-01-7 | Molecular Weight | 205.20900 |
|---|
| Density | / | Boiling Point | 359.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H4KNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.5ºC |
|---|
Names
| Name | potassium,4-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 359.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H4KNO4 |
|---|
| Molecular Weight | 205.20900 |
|---|
| Flash Point | 166.5ºC |
|---|
| Exact Mass | 204.97800 |
|---|
| PSA | 85.95000 |
|---|
| LogP | 0.48150 |
|---|
| Vapour Pressure | 8.78E-06mmHg at 25°C |
|---|
| InChIKey | MKBKSBKMELRIKB-UHFFFAOYSA-M |
|---|
| SMILES | O=C([O-])c1ccc([N+](=O)[O-])cc1.[K+] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Potassium 4-Nitrobenzoate |
| N0160 |
| Potassium 4-nitrobenzoate |
| potassium p-nitrobenzoate |
| 4-Nitro-benzoesaeure,Kalium-Verbindung |
| 4-Nitrobenzoic Acid Potassium Salt |
| p-NO2-C6H4COOK |
| 4-Nitrobenzoic Acid PotassiuM Salt |
| 4-nitro-benzoic acid,potassium-compound |
| 4-Nitrobenzoic acid potassium |
