Introduction：Basic information about CAS 536-45-8|sodium anisate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium anisate |
|---|
| CAS Number | 536-45-8 | Molecular Weight | 174.12900 |
|---|
| Density | 0.94g/cm3 | Boiling Point | 211.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H7NaO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 84.2ºC |
|---|
Names
| Name | sodium,4-methoxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.94g/cm3 |
|---|
| Boiling Point | 211.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H7NaO3 |
|---|
| Molecular Weight | 174.12900 |
|---|
| Flash Point | 84.2ºC |
|---|
| Exact Mass | 174.02900 |
|---|
| PSA | 49.36000 |
|---|
| LogP | 0.05870 |
|---|
| InChIKey | AETSDHMVQHOYPB-UHFFFAOYSA-M |
|---|
| SMILES | COc1ccc(C(=O)[O-])cc1.[Na+] |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| sodium p-methoxybenzoate |
| NaO2CC6H4-p-OMe |
| sodium 4-methoxyphenylacetate |
| sodium anisate |
| sodium 4-methoxyphenylcarboxylate |
| F9WFJ28MV9 |
| sodium para-methoxybenzoate |
| sodium 4-methoxybenzoate |
| UNII-F9WFJ28MV9 |
