Introduction：Basic information about CAS 915923-76-1|3-(5-methyltetrazol-2-yl)adamantan-1-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(5-methyltetrazol-2-yl)adamantan-1-amine |
|---|
| CAS Number | 915923-76-1 | Molecular Weight | 233.31300 |
|---|
| Density | 1.62g/cm3 | Boiling Point | 389.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19N5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.2ºC |
|---|
Names
| Name | 3-(5-methyltetrazol-2-yl)adamantan-1-amine |
|---|
Chemical & Physical Properties
| Density | 1.62g/cm3 |
|---|
| Boiling Point | 389.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19N5 |
|---|
| Molecular Weight | 233.31300 |
|---|
| Flash Point | 189.2ºC |
|---|
| Exact Mass | 233.16400 |
|---|
| PSA | 69.62000 |
|---|
| LogP | 1.68840 |
|---|
| Index of Refraction | 1.841 |
|---|
| InChIKey | CCEPUWOMZAMMPD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nnn(C23CC4CC(CC(N)(C4)C2)C3)n1 |
|---|
