Introduction：Basic information about CAS 73035-16-2|3-Acetylbenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Acetylbenzenesulfonyl chloride |
|---|
| CAS Number | 73035-16-2 | Molecular Weight | 218.657 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 347.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7ClO3S | Melting Point | 43-45ºC |
|---|
| MSDS | USA | Flash Point | 163.7±23.2 °C |
|---|
Names
| Name | 3-acetylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 347.0±25.0 °C at 760 mmHg |
|---|
| Melting Point | 43-45ºC |
|---|
| Molecular Formula | C8H7ClO3S |
|---|
| Molecular Weight | 218.657 |
|---|
| Flash Point | 163.7±23.2 °C |
|---|
| Exact Mass | 217.980438 |
|---|
| PSA | 59.59000 |
|---|
| LogP | 1.83 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | CGMBNEIGZOCPPP-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cccc(S(=O)(=O)Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzenesulfonyl chloride, 3-acetyl- |
| F2169-1121 |
| 3-Acetyl-benzenesulfonyl chloride |
| 3-Acetyl-benzol-sulfonsaeure-chlorid |
| 3-Acetyl-benzol-1-sulfonylchlorid |
| 3-ACETYLBENZENE-1-SULFONYL CHLORIDE |
| 3-Acetylbenzenesulfonyl chloride |
| m-chlorosulfonylacetophenone |
