Introduction：Basic information about CAS 190779-61-4|2,4-bis(bromomethyl)-1,3,5-triethylbenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-bis(bromomethyl)-1,3,5-triethylbenzene |
|---|
| CAS Number | 190779-61-4 | Molecular Weight | 348.11700 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 342.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20Br2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.2ºC |
|---|
Names
| Name | 2,4-bis(bromomethyl)-1,3,5-triethylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 342.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20Br2 |
|---|
| Molecular Weight | 348.11700 |
|---|
| Flash Point | 187.2ºC |
|---|
| Exact Mass | 345.99300 |
|---|
| LogP | 5.16360 |
|---|
| Vapour Pressure | 0.000149mmHg at 25°C |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | HPICIYNHRQVDCM-UHFFFAOYSA-N |
|---|
| SMILES | CCc1cc(CC)c(CBr)c(CC)c1CBr |
|---|
Synonyms
| 2,4-bis-bromomethyl-1,3,5-triethyl-benzene |
| BEN088 |
