Introduction：Basic information about CAS 113593-34-3|Flosatidil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Flosatidil |
|---|
| CAS Number | 113593-34-3 | Molecular Weight | 525.62700 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 585.2ºC at 760mmHg |
|---|
| Molecular Formula | C26H34F3N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 307.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 585.2ºC at 760mmHg |
|---|
| Molecular Formula | C26H34F3N3O3S |
|---|
| Molecular Weight | 525.62700 |
|---|
| Flash Point | 307.7ºC |
|---|
| Exact Mass | 525.22700 |
|---|
| PSA | 78.39000 |
|---|
| LogP | 5.61670 |
|---|
| Vapour Pressure | 1.12E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | MJOGWNMYQLVUOU-UHFFFAOYSA-N |
|---|
| SMILES | CSc1ccccc1N(Cc1cccc(C(F)(F)F)c1)C(=O)CN(CCN(C)C)C(=O)OCC(C)C |
|---|
