Introduction：Basic information about CAS 21228-13-7|Dorastine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dorastine |
|---|
| CAS Number | 21228-13-7 | Molecular Weight | 339.86200 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 516.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H22ClN3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 266ºC |
|---|
Names
| Name | 8-chloro-2-methyl-5-[2-(6-methylpyridin-3-yl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 516.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H22ClN3 |
|---|
| Molecular Weight | 339.86200 |
|---|
| Flash Point | 266ºC |
|---|
| Exact Mass | 339.15000 |
|---|
| PSA | 21.06000 |
|---|
| LogP | 4.16660 |
|---|
| Vapour Pressure | 9.13E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | WCTGYFWVYBPRGF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(CCn2c3c(c4cc(Cl)ccc42)CN(C)CC3)cn1 |
|---|
Synonyms
| 8-chloro-2-methyl-5-[2-(6-methyl-pyridin-3-yl)-ethyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| 8-chloro-2,3,4,5-tetrahydro-2.methyl-5-(2-(6-methylpyridin-3-yl)ethyl)-1H-pyrido[4,3-b]indole |
| Dorastine |
| Dorastine [INN] |
| 8-Chlor-1,3,4,5-tetrahydro-2-methyl-5-<2-(6-methyl-3-pyridyl)-aethyl>-2H-pyrido<4,3-b>indol |
| UNII-3087NKH40A |
