Introduction：Basic information about CAS 5579-27-1|2-Tetrazene,1,4-dimethyl-1,4-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Tetrazene,1,4-dimethyl-1,4-diphenyl- |
|---|
| CAS Number | 5579-27-1 | Molecular Weight | 240.30400 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 332.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H16N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.8ºC |
|---|
Names
| Name | N-methyl-N-[(E)-(N-methylanilino)diazenyl]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 332.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H16N4 |
|---|
| Molecular Weight | 240.30400 |
|---|
| Flash Point | 154.8ºC |
|---|
| Exact Mass | 240.13700 |
|---|
| PSA | 31.20000 |
|---|
| LogP | 3.54140 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | WRINSSLBPNLASA-FOCLMDBBSA-N |
|---|
| SMILES | CN(N=NN(C)c1ccccc1)c1ccccc1 |
|---|
Synonyms
| MPT |
| 1,4-diphenyltetrazene |
| 1,4-dimethyl-1,4-diphenyl-2-tetrazine |
| Centrazene |
| 1,4-Diphenyl-1,4-dimethyl-2-tetrazene |
| Simtrazene |
| 2-Tetrazene,4-dimethyl-1,4-diphenyl |
| 1,4-dimethyl-1,4-diphenyl-2-tetrazene |
| 1,4-Dimethyl-1,4-diphenyl-tetraz-2-en |
| 1,4-diphenyl-2-tetrazene |
| 1,4-dimethyl-1,4-diphenyl-tetraz-2-ene |
| 1,4-dimethyl-1,4-diphenyltetrazene |
