Introduction：Basic information about CAS 83573-53-9|Tizabrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tizabrin |
|---|
| CAS Number | 83573-53-9 | Molecular Weight | 205.27500 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 427.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H15NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.4ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 427.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H15NO3S |
|---|
| Molecular Weight | 205.27500 |
|---|
| Flash Point | 212.4ºC |
|---|
| Exact Mass | 205.07700 |
|---|
| PSA | 85.61000 |
|---|
| LogP | 1.15310 |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | GBNFAIIPJQPAHF-OCKPMXRZSA-N |
|---|
| SMILES | CC1CS(=O)C(C)(C)C(C(=O)O)N1 |
|---|
