Introduction：Basic information about CAS 15687-05-5|cloracetadol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cloracetadol |
|---|
| CAS Number | 15687-05-5 | Molecular Weight | 298.55000 |
|---|
| Density | 1.53g/cm3 | Boiling Point | 467ºC at 760mmHg |
|---|
| Molecular Formula | C10H10Cl3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.2ºC |
|---|
Names
| Name | cloracetadol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Boiling Point | 467ºC at 760mmHg |
|---|
| Molecular Formula | C10H10Cl3NO3 |
|---|
| Molecular Weight | 298.55000 |
|---|
| Flash Point | 236.2ºC |
|---|
| Exact Mass | 296.97300 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 2.78540 |
|---|
| Vapour Pressure | 1.61E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | NFZJQAPVHJPJMD-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(OC(O)C(Cl)(Cl)Cl)cc1 |
|---|
Synonyms
| chloracetadol |
| 4'-(2,2,2-Trichloro-1-hydroxyethoxy)acetanilide |
| Essigsaeure-[4-(2,2,2-trichlor-1-hydroxy-aethoxy)-anilid] |
| Cloracetadolum |
| Chloral-(4-acetamino-phenol) |
| acetic acid-[4-(2,2,2-trichloro-1-hydroxy-ethoxy)-anilide] |
| 1-(4-Acetamido-phenoxy)-2-trichlorethanol |
