Introduction：Basic information about CAS 90-85-7|2-[benzyl(methyl)amino]-1-phenylpropan-1-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[benzyl(methyl)amino]-1-phenylpropan-1-ol |
|---|
| CAS Number | 90-85-7 | Molecular Weight | 255.35500 |
|---|
| Density | 1.071g/cm3 | Boiling Point | 386.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.6ºC |
|---|
Names
| Name | 2-[benzyl(methyl)amino]-1-phenylpropan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.071g/cm3 |
|---|
| Boiling Point | 386.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO |
|---|
| Molecular Weight | 255.35500 |
|---|
| Flash Point | 145.6ºC |
|---|
| Exact Mass | 255.16200 |
|---|
| PSA | 23.47000 |
|---|
| LogP | 3.24050 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | KLNGFIBGXXNTLD-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(O)c1ccccc1)N(C)Cc1ccccc1 |
|---|
Synonyms
| (1R,2S)-1-phenyl-2-(N-methyl-N-benzylamino)propan-1-ol |
| (1R:2S)-2-(methyl-benzyl-amino)-1-phenyl-propanol-(1) |
| N-Benzyl-ephedrin |
| L-erythro-2-(Methyl-benzyl-amino)-1-phenyl-propanol-(1) |
| |A-(1-(methylbenzylamino)ethyl)benzyl alcohol |
| (1R,2S)-2-(benzyl(methyl)amino)-1-phenyl-1-propanol |
| N-benzylephedrine |
| (1R,2S)-N-benzyl-(-)-ephedrine |
