Introduction：Basic information about CAS 149961-52-4|dimoxystrobin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimoxystrobin |
|---|
| CAS Number | 149961-52-4 | Molecular Weight | 326.390 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C19H22N2O3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | dimoxystrobin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Molecular Formula | C19H22N2O3 |
|---|
| Molecular Weight | 326.390 |
|---|
| Exact Mass | 326.163055 |
|---|
| PSA | 59.92000 |
|---|
| LogP | 5.08 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | WXUZAHCNPWONDH-DYTRJAOYSA-N |
|---|
| SMILES | CNC(=O)C(=NOC)c1ccccc1COc1cc(C)ccc1C |
|---|
Safety Information
| Symbol |
GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H332-H400 |
|---|
| Precautionary Statements | P273 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn,N |
|---|
| Risk Phrases | R20 |
|---|
| Safety Phrases | S60 |
|---|
| RIDADR | UN3077 9/PG 3 |
|---|
Synonyms
| (aE)-2-[(2,5-Dimethylphenoxy)methyl]-a-(methoxyimino)-N-methylbenzeneacetamide |
| 8430159 |
| (E)-2-(methoxyimino)-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamide |
| (αE)-2-[(2,5-dimethylphenoxy)methyl]-α-(methoxyimino)-N-methylbenzeneacetamide |
| DIMOXYSTROBIN PESTANAL |
| (2E)-2-{2-[(2,5-Dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide |
| 1ONUYVM1&R B1OR B1 E1 &&E Form |
| Benzeneacetamide, 2-[(2,5-dimethylphenoxy)methyl]-α-(methoxyimino)-N-methyl-, (αE)- |
| (2E)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylethanamide |
| dimoxystrobin |
