Introduction：Basic information about CAS 1157-84-2|Benzaldehyde,2-(2,4-dinitrophenyl)hydrazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzaldehyde,2-(2,4-dinitrophenyl)hydrazone |
|---|
| CAS Number | 1157-84-2 | Molecular Weight | 286.24300 |
|---|
| Density | 1.39 g/cm3 | Boiling Point | 458.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10N4O4 | Melting Point | 239-241 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 231.1ºC |
|---|
| Symbol |
GHS02, GHS07 | Signal Word | Danger |
|---|
Names
| Name | benzaldehyde 2,4-dinitrophenylhydrazone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39 g/cm3 |
|---|
| Boiling Point | 458.5ºC at 760 mmHg |
|---|
| Melting Point | 239-241 °C(lit.) |
|---|
| Molecular Formula | C13H10N4O4 |
|---|
| Molecular Weight | 286.24300 |
|---|
| Flash Point | 231.1ºC |
|---|
| Exact Mass | 286.07000 |
|---|
| PSA | 116.03000 |
|---|
| LogP | 4.06840 |
|---|
| Vapour Pressure | 1.36E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | DZPRPFUXOZTWAJ-NTEUORMPSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccccc2)c([N+](=O)[O-])c1 |
|---|
| Storage condition | 2-8°C |
|---|
| Stability | Stable. Incompatible with strong oxidizing agents. |
|---|
Safety Information
| Symbol |
GHS02, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H302 + H312 + H332-H319 |
|---|
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
|---|
| Hazard Codes | T: Toxic;Xi: Irritant;F: Flammable;Xn: Harmful; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S45-S27-S16-S39 |
|---|
| RIDADR | UN 1648 3/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 1.0 |
|---|
| HS Code | 2928000090 |
|---|
Customs
| HS Code | 2928000090 |
|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| BENZALDEHYDE 2,4-DINTROPHENYLHYDRAZONE |
| benzaldehyde 2,4-dinitrohydrazone |
| BENZALDEHYDE (2,4-DINITROPHENYL)HYDRAZONE |
| Benzaldehyde-2,4-dinitrophenylhydrazone |
| BENZALDEHYDE-DNPH |
| Benzaldehyde-2,4-DNPH |
| BENZALDEHYDE-2,4-DNPH,100MG,NEAT |
| benzaldehyde-2,4-dnph solution |
| Benzaldehyde 2,4-Dinitrophenylhydrazone |
| DNP of benzaldehyde |
| MFCD00156353 |
| EINECS 200-835-2 |
