Introduction：Basic information about CAS 90162-40-6|[1,4-Phenylenebis(oxy)]bis(trimethylsilane), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1,4-Phenylenebis(oxy)]bis(trimethylsilane) |
|---|
| CAS Number | 90162-40-6 | Molecular Weight | 254.473 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 246.0±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H22O2Si2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 85.6±20.2 °C |
|---|
Names
| Name | 1,4-bis(trimethylsiloxy)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 246.0±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H22O2Si2 |
|---|
| Molecular Weight | 254.473 |
|---|
| Flash Point | 85.6±20.2 °C |
|---|
| Exact Mass | 254.115829 |
|---|
| PSA | 18.46000 |
|---|
| LogP | -3.37 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.462 |
|---|
| InChIKey | YIRZROVNUPFFNZ-UHFFFAOYSA-N |
|---|
| SMILES | CO[Si](OC)(OC)c1ccc([Si](OC)(OC)OC)cc1 |
|---|
Synonyms
| bis-Trimethoxysilylaethin |
| hexa-Si-methoxy-Si,Si'-ethynediyl-bis-silane |
| Benzene, 1,4-bis[(trimethylsilyl)oxy]- |
| 1.3-Bis-(trimethoxysilyl)-benzol |
| 2,7-Dioxa-3,6-disilaoct-4-yne,3,3,6,6-tetramethoxy |
| bis-(trimethoxy silyl) ethine |
| bis(trimethoxysilyl)acetylene |
| Hexa-Si-methoxy-Si,Si'-aethindiyl-bis-silan |
| Bis-trimethoxysilyl-acetylen |
| [1,4-Phenylenebis(oxy)]bis(trimethylsilane) |
| Bis-trimethyoxysilyl-acetylen |
| 1,4-bis(trimethoxysilyl)benzene |
| bis(trimethoxysilyl)benzene |
