Introduction：Basic information about CAS 1514-90-5|perfluoroisopentyl iodide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluoroisopentyl iodide |
|---|
| CAS Number | 1514-90-5 | Molecular Weight | 395.94000 |
|---|
| Density | 2,045 g/cm3 | Boiling Point | 89-90°C |
|---|
| Molecular Formula | C5F11I | Melting Point | / |
|---|
| MSDS | / | Flash Point | 33.6ºC |
|---|
Names
| Name | 1,1,1,2,3,3,4,4-octafluoro-4-iodo-2-(trifluoromethyl)butane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2,045 g/cm3 |
|---|
| Boiling Point | 89-90°C |
|---|
| Molecular Formula | C5F11I |
|---|
| Molecular Weight | 395.94000 |
|---|
| Flash Point | 33.6ºC |
|---|
| Exact Mass | 395.88700 |
|---|
| LogP | 4.48240 |
|---|
| Vapour Pressure | 49.6mmHg at 25°C |
|---|
| Index of Refraction | 1.334 |
|---|
| InChIKey | UMPRKACBONFPEQ-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)I |
|---|
| Stability | Stable. |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| PC6089B |
| 2-trifluoromethylperfluorobutyl iodide |
| 3-trifluoromethylperfluorobutyl iodide |
| 1-Iod-perfluor-isopentan |
| 1,1,1,2,3,3,4,4-octafluoro-4-iodo-2-trifluoromethyl-butane |
| perfluoro-1-iodoisopentane |
| 1-Iod-undecafluor-3-methyl-butan |
| Perfluoro-3-methylbutyl iodide |
| MFCD00153244 |
| Perfluoroisopentyl iodide |
