Introduction:Basic information about CAS 1551-39-9|tetrafluoroisophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetrafluoroisophthalic acid |
|---|
| CAS Number | 1551-39-9 | Molecular Weight | 238.09300 |
|---|
| Density | 1.812g/cm3 | Boiling Point | 351.8ºC at 760mmHg |
|---|
| Molecular Formula | C8H2F4O4 | Melting Point | 212-214 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 166.6ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | tetrafluoroisophthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.812g/cm3 |
|---|
| Boiling Point | 351.8ºC at 760mmHg |
|---|
| Melting Point | 212-214 °C(lit.) |
|---|
| Molecular Formula | C8H2F4O4 |
|---|
| Molecular Weight | 238.09300 |
|---|
| Flash Point | 166.6ºC |
|---|
| Exact Mass | 237.98900 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.63940 |
|---|
| Vapour Pressure | 1.48E-05mmHg at 25°C |
|---|
| InChIKey | PGRIMKUYGUHAKH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c(F)c(F)c(F)c(C(=O)O)c1F |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | 2811 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,4,5,6-tetrafluorobenzene-1,3-dicarboxylic acid |
| Tetrafluoroisophthalic acid |
| MFCD00042379 |