Introduction：Basic information about CAS 355-25-9|decafluorobutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | decafluorobutane |
|---|
| CAS Number | 355-25-9 | Molecular Weight | 238.02700 |
|---|
| Density | 1,517 g/cm3 | Boiling Point | -2 °C |
|---|
| Molecular Formula | C4F10 | Melting Point | -84,5°C |
|---|
| MSDS | / | Flash Point | 4.2ºC |
|---|
Names
| Name | 1,1,1,2,2,3,3,4,4,4-decafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,517 g/cm3 |
|---|
| Boiling Point | -2 °C |
|---|
| Melting Point | -84,5°C |
|---|
| Molecular Formula | C4F10 |
|---|
| Molecular Weight | 238.02700 |
|---|
| Flash Point | 4.2ºC |
|---|
| Exact Mass | 237.98400 |
|---|
| LogP | 3.38160 |
|---|
| Index of Refraction | 1.233 |
|---|
| InChIKey | KAVGMUDTWQVPDF-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | S3-S7 |
|---|
| RIDADR | 3163 |
|---|
| Hazard Class | 2.2 |
|---|
| HS Code | 2903399090 |
|---|
Customs
| HS Code | 2903399090 |
|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| CEA 410 |
| FC 3110 |
| Butane,decafluoro |
| Sonazoid |
| EINECS 206-580-3 |
| Perfluorobutane |
| n-perfluorobutane |
| Perflubutane |
| MFCD00042080 |
| perfluoro-n-butane |
| DECAFLUOROBUTANE |
