Introduction：Basic information about CAS 26608-34-4|Etioporphyrin III, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Etioporphyrin III |
|---|
| CAS Number | 26608-34-4 | Molecular Weight | 478.67100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C32H38N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Etioporphyrin III |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C32H38N4 |
|---|
| Molecular Weight | 478.67100 |
|---|
| Exact Mass | 478.31000 |
|---|
| PSA | 56.30000 |
|---|
| LogP | 5.16550 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | SOZGZCJUYXLGOI-UHFFFAOYSA-N |
|---|
| SMILES | CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(C)=C5CC)c(C)c4CC)c(CC)c3C |
|---|
Synonyms
| 2,7,12,18-Tetraaethyl-3,8,13,17-tetramethyl-porphyrin |
| Etioporphyrin 3 |
| 2,7,12,18-tetraethyl-3,8,13,17-tetramethyl-porphyrin |
| aetioporphyrin-III |
| 3,8,13,17-tetraethyl-2,7,12,18-tetramethylporphyrin |
| 2,7,12,18-Tetraethyl-3,8,13,17-tetramethyl-21H,23H-porphyrin |
| 2,7,12,18-tetraethyl-3,8,13,17-tetramethyl-21H,23H-porphine |
