Introduction:Basic information about CAS 306936-64-1|1-(3,5-DICHLORO-4-PYRIDYL)HYDRAZINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(3,5-DICHLORO-4-PYRIDYL)HYDRAZINE |
|---|
| CAS Number | 306936-64-1 | Molecular Weight | 317.59800 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 440.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H11Cl3N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.2ºC |
|---|
Names
| Name | 1-(3,5-dichlorophenyl)-5-propylpyrazole-4-carbonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 440.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H11Cl3N2O |
|---|
| Molecular Weight | 317.59800 |
|---|
| Flash Point | 220.2ºC |
|---|
| Exact Mass | 315.99400 |
|---|
| PSA | 34.89000 |
|---|
| LogP | 4.51060 |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | TZOYLCXIRKLUQO-UHFFFAOYSA-N |
|---|
| SMILES | CCCc1c(C(=O)Cl)cnn1-c1cc(Cl)cc(Cl)c1 |
|---|