Introduction:Basic information about CAS 300665-29-6|2-(CHLOROMETHYL)-5-(2-NAPHTHYL)-1,3,4-OXADIAZOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(CHLOROMETHYL)-5-(2-NAPHTHYL)-1,3,4-OXADIAZOLE |
|---|
| CAS Number | 300665-29-6 | Molecular Weight | 244.67600 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 420.8ºC at 760mmHg |
|---|
| Molecular Formula | C13H9ClN2O | Melting Point | 128ºC |
|---|
| MSDS | / | Flash Point | 208.3ºC |
|---|
Names
| Name | 2-(chloromethyl)-5-naphthalen-2-yl-1,3,4-oxadiazole |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 420.8ºC at 760mmHg |
|---|
| Melting Point | 128ºC |
|---|
| Molecular Formula | C13H9ClN2O |
|---|
| Molecular Weight | 244.67600 |
|---|
| Flash Point | 208.3ºC |
|---|
| Exact Mass | 244.04000 |
|---|
| PSA | 38.92000 |
|---|
| LogP | 3.62860 |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | UMNGOHKHXNBZFZ-UHFFFAOYSA-N |
|---|
| SMILES | ClCc1nnc(-c2ccc3ccccc3c2)o1 |
|---|