Introduction：Basic information about CAS 38550-44-6|2-IODO-1H,1H,2H,3H,3H-PERFLUORONONAN-1-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-IODO-1H,1H,2H,3H,3H-PERFLUORONONAN-1-OL |
|---|
| CAS Number | 38550-44-6 | Molecular Weight | 504.02700 |
|---|
| Density | 1.902g/cm3 | Boiling Point | 216.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H6F13IO | Melting Point | 45ºC |
|---|
| MSDS | / | Flash Point | 84.6ºC |
|---|
Names
| Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-iodononan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.902g/cm3 |
|---|
| Boiling Point | 216.3ºC at 760mmHg |
|---|
| Melting Point | 45ºC |
|---|
| Molecular Formula | C9H6F13IO |
|---|
| Molecular Weight | 504.02700 |
|---|
| Flash Point | 84.6ºC |
|---|
| Exact Mass | 503.92600 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.91120 |
|---|
| Index of Refraction | 1.371 |
|---|
| InChIKey | JIDYQTCBVGBFDH-UHFFFAOYSA-N |
|---|
| SMILES | OCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2905590090 |
|---|
Customs
| HS Code | 2905590090 |
|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 3-perfluoro-n-hexyl-2-iodo-1-propanol |
| 2-iodo-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononan-1-ol |
| 3-Perfluorohexyl-2-iodopropan-1-ol |
| 1-Hydroxy-2-iodo-3-perfluorohexylpropane |
| PC6088D |
| 2-Iodo-4,4,5,6,6,7,7,8,8,9,9-tridecafluorononanol |
| 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-iodononan-1-ol |
