Introduction：Basic information about CAS 5701-82-6|Terameprocol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Terameprocol |
|---|
| CAS Number | 5701-82-6 | Molecular Weight | 358.471 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 458.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H30O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 108.8±34.2 °C |
|---|
Names
| Name | 4-[4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-1,2-dimethoxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 458.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H30O4 |
|---|
| Molecular Weight | 358.471 |
|---|
| Flash Point | 108.8±34.2 °C |
|---|
| Exact Mass | 358.214417 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 5.86 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.522 |
|---|
| InChIKey | ORQFDHFZSMXRLM-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CC(C)C(C)Cc2ccc(OC)c(OC)c2)cc1OC |
|---|
Synonyms
| Tetra-O-methylnordihydroguaiaretic acid |
| meso-1,4-bis-(3,4-dimethoxy-phenyl)-2,3-dimethyl-butane |
| Tmndga |
| dihydroguairetic acid dimethylether |
| 1,4-bis-(3,4-dimethoxyphenyl)-2,3-dimethylbutane |
| 2,3-dimethyl-1,4-bis-(3,4-dimethoxyphenyl)-butane |
| Tetra-O-methyl-ndga |
| 1,1'-(2,3-dimethylbutane-1,4-diyl)bis(3,4-dimethoxybenzene) |
| Tetramethoxynordihydroguaiaretic acid |
| 1,1'-(2,3-Dimethyl-1,4-butanediyl)bis(3,4-dimethoxybenzene) |
| meso-dihydroguaiaretic acid dimethyl ether |
| 4,4'-(2,3-Dimethyl-1,4-butanediyl)bis-1,2-dimethoxybenzene |
| FW 358.2 |
| meso-1,4-Bis-(3,4-dimethoxy-phenyl)-2,3-dimethyl-butan |
| Benzene, 1,1'-(2,3-dimethyl-1,4-butanediyl)bis[3,4-dimethoxy- |
