Introduction：Basic information about CAS 55114-29-9|Propanedioic acid,2-butyl-2-methyl-, 1,3-diethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propanedioic acid,2-butyl-2-methyl-, 1,3-diethyl ester |
|---|
| CAS Number | 55114-29-9 | Molecular Weight | 230.30100 |
|---|
| Density | 0.968 g/cm3 | Boiling Point | 118-119ºC 9mm |
|---|
| Molecular Formula | C12H22O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 107.1ºC |
|---|
Names
| Name | diethyl 2-butyl-2-methylpropanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.968 g/cm3 |
|---|
| Boiling Point | 118-119ºC 9mm |
|---|
| Molecular Formula | C12H22O4 |
|---|
| Molecular Weight | 230.30100 |
|---|
| Flash Point | 107.1ºC |
|---|
| Exact Mass | 230.15200 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.30910 |
|---|
| Index of Refraction | 1.436 |
|---|
| InChIKey | VRSFJMZKROGYJJ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(C)(C(=O)OCC)C(=O)OCC |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| ethyl 2-methyl-2-carboethoxyhexanoate |
| butylmethylpropanedioic acid diethyl ester |
| Butyl-methyl-malonsaeure-diaethylester |
| diethyl n-butylmethylmalonate |
| diethyl butylmethylmalonate |
| ethyl 2-butyl-2-methylmalonate |
| butyl-methyl-malonic acid diethyl ester |
