Introduction:Basic information about CAS 42414-19-7|N-(2-naphthyl)-3-oxobutanamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2-naphthyl)-3-oxobutanamide |
|---|
| CAS Number | 42414-19-7 | Molecular Weight | 227.25900 |
|---|
| Density | 1.216g/cm3 | Boiling Point | 471.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.8ºC |
|---|
Names
| Name | N-naphthalen-2-yl-3-oxobutanamide |
|---|
Chemical & Physical Properties
| Density | 1.216g/cm3 |
|---|
| Boiling Point | 471.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13NO2 |
|---|
| Molecular Weight | 227.25900 |
|---|
| Flash Point | 198.8ºC |
|---|
| Exact Mass | 227.09500 |
|---|
| PSA | 46.17000 |
|---|
| LogP | 2.83040 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | SJZXYYGWOBQVKI-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)Nc1ccc2ccccc2c1 |
|---|