Introduction：Basic information about CAS 113882-33-0|3-Methyl-5-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methyl-5-nitrobenzoic acid |
|---|
| CAS Number | 113882-33-0 | Molecular Weight | 181.145 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 355.8±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7NO4 | Melting Point | 174℃ |
|---|
| MSDS | / | Flash Point | 161.1±13.0 °C |
|---|
Names
| Name | 3-Methyl-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 355.8±30.0 °C at 760 mmHg |
|---|
| Melting Point | 174℃ |
|---|
| Molecular Formula | C8H7NO4 |
|---|
| Molecular Weight | 181.145 |
|---|
| Flash Point | 161.1±13.0 °C |
|---|
| Exact Mass | 181.037506 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.28 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | XAPRFOJQNGFJSZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)O)cc([N+](=O)[O-])c1 |
|---|
Safety Information
Synonyms
| 3-methyl-5-nitro-benzoic acid |
| 3-Methyl-5-nitrobenzoic acid |
| 5-Methyl-3-nitrobenzoic acid |
| Benzoic acid,3-methyl-5-nitro |
| 3-Methyl-5-nitro-benzoesaeure |
| Benzoic acid, 3-methyl-5-nitro- |
| 5-Nitro-m-toluylsaeure |
| 3-nitro-5-methylbenzoic acid |
