Introduction：Basic information about CAS 1160995-45-8|2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine |
|---|
| CAS Number | 1160995-45-8 | Molecular Weight | 233.012 |
|---|
| Density | 2.0±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H2Cl2N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.0±0.1 g/cm3 |
|---|
| Molecular Formula | C6H2Cl2N4O2 |
|---|
| Molecular Weight | 233.012 |
|---|
| Exact Mass | 231.955475 |
|---|
| PSA | 76.01000 |
|---|
| LogP | 1.93 |
|---|
| Index of Refraction | 1.806 |
|---|
| InChIKey | UILXDKCIJUPNOF-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc2c(Cl)nc(Cl)nn2c1 |
|---|
Synonyms
| SC3031 |
| X9155 |
| 2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine |
| 2,4-Dichloro-6-(nitro)pyrrolo[2,1-f][1,2,4]triazine |
| Pyrrolo[2,1-f][1,2,4]triazine, 2,4-dichloro-6-nitro- |
