Introduction：Basic information about CAS 261789-00-8|2-(2,5-Dimethoxy-4-nitrophenyl)ethanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2,5-Dimethoxy-4-nitrophenyl)ethanamine |
|---|
| CAS Number | 261789-00-8 | Molecular Weight | 226.229 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 394.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.3±26.5 °C |
|---|
Names
| Name | 2-(2,5-dimethoxy-4-nitrophenyl)ethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 394.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O4 |
|---|
| Molecular Weight | 226.229 |
|---|
| Flash Point | 192.3±26.5 °C |
|---|
| Exact Mass | 226.095352 |
|---|
| PSA | 90.30000 |
|---|
| LogP | 1.24 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | ZMUSDZGRRJGRAO-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1CCN |
|---|
Synonyms
| Benzeneethanamine, 2,5-dimethoxy-4-nitro- |
| Benzeneethanamine,2,5-dimethoxy-4-nitro |
| 2C-N |
| 2-(2,5-Dimethoxy-4-nitrophenyl)ethanamine |
| 2,4-DIMETHOXY-3-METHYL-5-NITROANILINE |
| 2,5-Dimethoxy-4-nitro-benzeneethanamine |
