Introduction：Basic information about CAS 120054-86-6|Dexniguldipine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dexniguldipine |
|---|
| CAS Number | 120054-86-6 | Molecular Weight | 609.71100 |
|---|
| Density | 1.205g/cm3 | Boiling Point | 729.5ºC at 760mmHg |
|---|
| Molecular Formula | C36H39N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 395ºC |
|---|
Names
| Name | 5-O-(4,4-diphenylpiperidin-1-yl) 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1-propyl-4H-pyridine-3,5-dicarboxylate |
|---|
Chemical & Physical Properties
| Density | 1.205g/cm3 |
|---|
| Boiling Point | 729.5ºC at 760mmHg |
|---|
| Molecular Formula | C36H39N3O6 |
|---|
| Molecular Weight | 609.71100 |
|---|
| Flash Point | 395ºC |
|---|
| Exact Mass | 609.28400 |
|---|
| PSA | 113.69000 |
|---|
| LogP | 6.80790 |
|---|
| Vapour Pressure | 3.9E-21mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | SVJMLYUFVDMUHP-MGBGTMOVSA-N |
|---|
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
|---|
