Introduction：Basic information about CAS 95761-91-4|cefotiam hexetil ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cefotiam hexetil ester |
|---|
| CAS Number | 95761-91-4 | Molecular Weight | 695.83400 |
|---|
| Density | 1.63g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C27H37N9O7S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | cefotiam hexetil ester |
|---|
Chemical & Physical Properties
| Density | 1.63g/cm3 |
|---|
| Molecular Formula | C27H37N9O7S3 |
|---|
| Molecular Weight | 695.83400 |
|---|
| Exact Mass | 695.19800 |
|---|
| PSA | 280.05000 |
|---|
| LogP | 2.34560 |
|---|
| Index of Refraction | 1.751 |
|---|
| InChIKey | VVFDMWZLBPUKTD-ZKRNHDOASA-N |
|---|
| SMILES | CC(OC(=O)OC1CCCCC1)OC(=O)C1=C(CSc2nnnn2CCN(C)C)CSC2C(NC(=O)Cc3csc(N)n3)C(=O)N12 |
|---|
