Introduction:Basic information about CAS 26560-90-7|Tetrakis(1,1,1,3,3,3-hexafluoroisopropyl) Orthosilicate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetrakis(1,1,1,3,3,3-hexafluoroisopropyl) Orthosilicate |
|---|
| CAS Number | 26560-90-7 | Molecular Weight | 696.205 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 174.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H4F24O4Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 59.4±27.3 °C |
|---|
Names
| Name | tetrakis(1,1,1,3,3,3-hexafluoropropan-2-yl) silicate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 174.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H4F24O4Si |
|---|
| Molecular Weight | 696.205 |
|---|
| Flash Point | 59.4±27.3 °C |
|---|
| Exact Mass | 695.949585 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 15.68 |
|---|
| Vapour Pressure | 1.6±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.293 |
|---|
| InChIKey | BBAPGYPPYPFUOP-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(O[Si](OC(C(F)(F)F)C(F)(F)F)(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
|---|
Synonyms
| Tetrakis(1,1,1,3,3,3-hexafluoro-2-propanyl) orthosilicate |
| tetrakis(1,1,1,3,3,3-hexafluoro-2-propoxy)silane |
| Silicic acid (HSiO), tetrakis[2,2,2-trifluoro-1-(trifluoromethyl)ethyl] ester |
| Tetrakis(1,1,1,3,3,3-hexafluoroisopropoxy)silane |
| Tetrakis(1,1,1,3,3,3-hexafluoropropan-2-yl) orthosilicate |
| Tetrakis(1,1,1,3,3,3-hexafluoroisopropyl) Orthosilicate |