Introduction:Basic information about CAS 84725-45-1|2-Methyl-1-(4-phenyl-1-piperazinyl)-2-propanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-1-(4-phenyl-1-piperazinyl)-2-propanamine |
|---|
| CAS Number | 84725-45-1 | Molecular Weight | 233.35300 |
|---|
| Density | 1.027g/cm3 | Boiling Point | 353.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H23N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.1ºC |
|---|
Names
| Name | 2-Methyl-1-(4-phenyl-1-piperazinyl)-2-propanamine |
|---|
Chemical & Physical Properties
| Density | 1.027g/cm3 |
|---|
| Boiling Point | 353.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H23N3 |
|---|
| Molecular Weight | 233.35300 |
|---|
| Flash Point | 165.1ºC |
|---|
| Exact Mass | 233.18900 |
|---|
| PSA | 32.50000 |
|---|
| LogP | 2.24910 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | VHBCSGDLYUIWQW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(N)CN1CCN(c2ccccc2)CC1 |
|---|