Introduction：Basic information about CAS 157982-71-3|Benzyl 10-iodo-2-oxo-1-oxa-6-azaspiro[4.5]decane-6-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyl 10-iodo-2-oxo-1-oxa-6-azaspiro[4.5]decane-6-carboxylate |
|---|
| CAS Number | 157982-71-3 | Molecular Weight | 415.22300 |
|---|
| Density | 1.659g/cm3 | Boiling Point | 550.156ºC at 760 mmHg |
|---|
| Molecular Formula | C16H18INO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.524ºC |
|---|
Names
| Name | Benzyl 10-iodo-2-oxo-1-oxa-6-azaspiro[4.5]decane-6-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.659g/cm3 |
|---|
| Boiling Point | 550.156ºC at 760 mmHg |
|---|
| Molecular Formula | C16H18INO4 |
|---|
| Molecular Weight | 415.22300 |
|---|
| Flash Point | 286.524ºC |
|---|
| Exact Mass | 415.02800 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 3.19380 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | CBKNAIGFQWYWJE-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCC2(O1)C(I)CCCN2C(=O)OCc1ccccc1 |
|---|
