Introduction：Basic information about CAS 157982-73-5|Benzyl 2-oxo-1-oxa-6-azaspiro[4.5]decane-6-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyl 2-oxo-1-oxa-6-azaspiro[4.5]decane-6-carboxylate |
|---|
| CAS Number | 157982-73-5 | Molecular Weight | 289.32600 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 487.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 248.4ºC |
|---|
Names
| Name | Benzyl 2-oxo-1-oxa-6-azaspiro[4.5]decane-6-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 487.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19NO4 |
|---|
| Molecular Weight | 289.32600 |
|---|
| Flash Point | 248.4ºC |
|---|
| Exact Mass | 289.13100 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 2.78030 |
|---|
| Vapour Pressure | 1.22E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | RRHCNGIAZSFHCO-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCC2(CCCCN2C(=O)OCc2ccccc2)O1 |
|---|
