Introduction：Basic information about CAS 87399-97-1|2-Benzyl-8,8-dimethyl-9-oxa-2-azaspiro[5.5]undecane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Benzyl-8,8-dimethyl-9-oxa-2-azaspiro[5.5]undecane |
|---|
| CAS Number | 87399-97-1 | Molecular Weight | 273.41300 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 367ºC at 760 mmHg |
|---|
| Molecular Formula | C18H27NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 108.3ºC |
|---|
Names
| Name | 2-Benzyl-8,8-dimethyl-9-oxa-2-azaspiro[5.5]undecane |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 367ºC at 760 mmHg |
|---|
| Molecular Formula | C18H27NO |
|---|
| Molecular Weight | 273.41300 |
|---|
| Flash Point | 108.3ºC |
|---|
| Exact Mass | 273.20900 |
|---|
| PSA | 12.47000 |
|---|
| LogP | 3.79570 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | GEHJWDOESWZZTK-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CC2(CCCN(Cc3ccccc3)C2)CCO1 |
|---|
