Introduction：Basic information about CAS 15769-07-0|2,6-Bis(methylsulfonyl)-2,6-diazaspiro[3.3]heptane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Bis(methylsulfonyl)-2,6-diazaspiro[3.3]heptane |
|---|
| CAS Number | 15769-07-0 | Molecular Weight | 254.32700 |
|---|
| Density | 1.58g/cm3 | Boiling Point | 428.5ºC at 760 mmHg |
|---|
| Molecular Formula | C7H14N2O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.9ºC |
|---|
Names
| Name | 2,6-Bis(methylsulfonyl)-2,6-diazaspiro[3.3]heptane |
|---|
Chemical & Physical Properties
| Density | 1.58g/cm3 |
|---|
| Boiling Point | 428.5ºC at 760 mmHg |
|---|
| Molecular Formula | C7H14N2O4S2 |
|---|
| Molecular Weight | 254.32700 |
|---|
| Flash Point | 212.9ºC |
|---|
| Exact Mass | 254.03900 |
|---|
| PSA | 91.52000 |
|---|
| LogP | 0.56060 |
|---|
| Vapour Pressure | 1.51E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | GKXSOXMBYTXKEA-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)N1CC2(C1)CN(S(C)(=O)=O)C2 |
|---|
