Introduction:Basic information about CAS 26218-04-2|2-Ethylhexyl 4-aminobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Ethylhexyl 4-aminobenzoate |
|---|
| CAS Number | 26218-04-2 | Molecular Weight | 249.34900 |
|---|
| Density | 1.016g/cm3 | Boiling Point | 384.962ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.018ºC |
|---|
Names
| Name | 2-Ethylhexyl 4-aminobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.016g/cm3 |
|---|
| Boiling Point | 384.962ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO2 |
|---|
| Molecular Weight | 249.34900 |
|---|
| Flash Point | 222.018ºC |
|---|
| Exact Mass | 249.17300 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 4.22320 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | ZJQXUTDROPGVLH-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)COC(=O)c1ccc(N)cc1 |
|---|
Safety Information
| Hazard Codes | N: Dangerous for the environment; |
|---|
| Risk Phrases | 50/53 |
|---|
| Safety Phrases | 60-61 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Ethylhexyl nitrate |
| nitric ester of 2-ethyl-1-hexanol |
| 2-ethylhexanol nitrate |
| 3-nitrooxymethyl-heptane |
| 2-ethylhexyl para-aminobenzoate |
| 2-ethyl hexylnitrate |
| 2-Aethyl-hexylnitrat |
| NITRIC ACID,2-ETHYLHEXYL ESTER |
| 2-ethyl-hexyl 4-aminobenzoate |
| DSSTox_CID_7928 |
| 2-ethyl-hexyl p-aminobenzoate |
| 2-Ethylhexyl p-aminobenzoate |
| p-Aminobenzoic acid 2-ethylhexyl ester |