Introduction:Basic information about CAS 73404-00-9|1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol |
|---|
| CAS Number | 73404-00-9 | Molecular Weight | 389.53000 |
|---|
| Density | 1.087g/cm3 | Boiling Point | 512.6ºC at 760 mmHg |
|---|
| Molecular Formula | C26H31NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 263.8ºC |
|---|
Names
| Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.087g/cm3 |
|---|
| Boiling Point | 512.6ºC at 760 mmHg |
|---|
| Molecular Formula | C26H31NO2 |
|---|
| Molecular Weight | 389.53000 |
|---|
| Flash Point | 263.8ºC |
|---|
| Exact Mass | 389.23500 |
|---|
| PSA | 32.70000 |
|---|
| LogP | 4.88580 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | ZHLXWJSSVXYFJC-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCOc1ccc(C(O)(Cc2ccccc2)c2ccccc2)cc1 |
|---|
Synonyms
| Benzeneethanol,a-[4-[2-(diethylamino)ethoxy]phenyl]-a-phenyl |
| Ethanol,1-[p-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenyl-(6CI,7CI) |
| EINECS 277-461-1 |
| 1-<4-(2-Diaethylamino-aethoxy)-phenyl>-1,2-diphenyl-aethanol |
| 1-[4-(2-diethylaminoethyloxy)phenyl]-1,2-diphenylethanol |