Introduction：Basic information about CAS 875548-97-3|4'-Fluoro-2'-methoxy-5'-isopropyl-4-trifluoromethyl-1,1'-biphenyl-2-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Fluoro-2'-methoxy-5'-isopropyl-4-trifluoromethyl-1,1'-biphenyl-2- methanol |
|---|
| CAS Number | 875548-97-3 | Molecular Weight | 342.328 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 364.5±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H18F4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.0±24.4 °C |
|---|
Names
| Name | [2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 364.5±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H18F4O2 |
|---|
| Molecular Weight | 342.328 |
|---|
| Flash Point | 168.0±24.4 °C |
|---|
| Exact Mass | 342.124298 |
|---|
| PSA | 29.46000 |
|---|
| LogP | 4.75 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | XSZIJSCGSTXKKI-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(F)c(C(C)C)cc1-c1ccc(C(F)(F)F)cc1CO |
|---|
Synonyms
| 4'-FLUORO-2'-METHOXY-5'-ISOPROPYL-4-TRIFLUOROMETHYL-1,1'-BIPHENYL-2-METHANOL |
| (4'-FLUORO-5'-ISOPROPYL-2'-METHOXY-4-TRIFLUOROMETHYL-BIPHENYL-2-YL)METHANOL |
| [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol |
| [1,1'-Biphenyl]-2-methanol, 4'-fluoro-2'-methoxy-5'-(1-methylethyl)-4-(trifluoromethyl)- |
| [4'-fluoro-2'-methoxy-5'-(propan-2-yl)-4-(trifluoromethyl)biphenyl-2-yl]methanol |
| 4'-Fluoro-2'-methoxy-5'-isopropyl-4-trifluoromethyl-1,1'-biphenyl-2- methanol |
| Anacetrapib Intermediate 5 |
