Introduction：Basic information about CAS 190189-98-1|2-Boc-amino-4-bromomethylpyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Boc-amino-4-bromomethylpyridine |
|---|
| CAS Number | 190189-98-1 | Molecular Weight | 287.15300 |
|---|
| Density | 1.427g/cm3 | Boiling Point | 330.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H15BrN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 153.9ºC |
|---|
Names
| Name | tert-butyl 3-amino-4-(bromomethyl)pyridine-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.427g/cm3 |
|---|
| Boiling Point | 330.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H15BrN2O2 |
|---|
| Molecular Weight | 287.15300 |
|---|
| Flash Point | 153.9ºC |
|---|
| Exact Mass | 286.03200 |
|---|
| PSA | 54.71000 |
|---|
| LogP | 3.33710 |
|---|
| Vapour Pressure | 0.000162mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | TWFAMEOZPYPOIV-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)Nc1cc(CBr)ccn1 |
|---|
Synonyms
| 4-bromomethyl-2-tert-butoxycarbonylaminopyridine |
| 2-N-Boc-Amino-4-bromomethyl pyridine |
| 2-Boc-amino-4-bromomethylpyridine |
