Introduction:Basic information about CAS 54393-89-4|2-Nitro-4-(propylthio)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Nitro-4-(propylthio)aniline |
|---|
| CAS Number | 54393-89-4 | Molecular Weight | 212.26900 |
|---|
| Density | 1.25 g/cm3 | Boiling Point | 363.5ºC |
|---|
| Molecular Formula | C9H12N2O2S | Melting Point | 110-114ºC |
|---|
| MSDS | / | Flash Point | 173.6ºC |
|---|
Names
| Name | 2-nitro-4-propylsulfanylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25 g/cm3 |
|---|
| Boiling Point | 363.5ºC |
|---|
| Melting Point | 110-114ºC |
|---|
| Molecular Formula | C9H12N2O2S |
|---|
| Molecular Weight | 212.26900 |
|---|
| Flash Point | 173.6ºC |
|---|
| Exact Mass | 212.06200 |
|---|
| PSA | 97.14000 |
|---|
| LogP | 3.78350 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | LFZBJSIIHWNZAW-UHFFFAOYSA-N |
|---|
| SMILES | CCCSc1ccc(N)c([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Propylthio-2-nitro-anilin |
| 2-Nitro-4-propylthio-anilin |
| 4-(1-propyl sulfenyl)-2-nitroaniline |
| 2-Nitro-4-(propylthio)aniline |
| 1-amino-2-nitro-4-n-propylthiobenzene |
| 2-nitro-4-propylthiophenylamine |
| 4-propylthio-2-nitroaniline |
| 2-nitro-4-(propylsulfanyl)aniline |