Introduction：Basic information about CAS 850807-07-7|Ethyl 3-fluoro-5-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 3-fluoro-5-nitrobenzoate |
|---|
| CAS Number | 850807-07-7 | Molecular Weight | 213.16300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H8FNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Ethyl 3-fluoro-5-nitrobenzoate |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H8FNO4 |
|---|
| Molecular Weight | 213.16300 |
|---|
| Exact Mass | 213.04400 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 2.43380 |
|---|
| InChIKey | ZYDCODASTCWZBP-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(F)cc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
