Introduction：Basic information about CAS 1160556-64-8|2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl |
|---|
| CAS Number | 1160556-64-8 | Molecular Weight | 436.61200 |
|---|
| Density | / | Boiling Point | 592.8±50.0 °C |
|---|
| Molecular Formula | C28H41N2P | Melting Point | 111-113 °C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2'-(Dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiam ine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 592.8±50.0 °C |
|---|
| Melting Point | 111-113 °C |
|---|
| Molecular Formula | C28H41N2P |
|---|
| Molecular Weight | 436.61200 |
|---|
| Exact Mass | 436.30100 |
|---|
| PSA | 20.07000 |
|---|
| LogP | 7.25820 |
|---|
| InChIKey | DRNAQRXLOSUHBQ-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1cccc(N(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2-Dicyclohexylphosphino-2',6'-bis(N,N-dimethylamino)biphenyl |
| 2'-(dicyclohexylphosphino)-N2,N2,N6,N6-tetramethylbiphenyl-2,6-diamine |
| 2-(Dicyanomethylen)indan |
| MALONONITRILE,(2-INDANYLIDENE) |
| (2-Indanylidene)malononitrile |
