Introduction：Basic information about CAS 112405-99-9|4-Ethyl-1-phenyl-1,3-octanedione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Ethyl-1-phenyl-1,3-octanedione |
|---|
| CAS Number | 112405-99-9 | Molecular Weight | 246.345 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 351.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H22O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 132.0±17.4 °C |
|---|
Names
| Name | 4-ethyl-1-phenyloctane-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 351.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H22O2 |
|---|
| Molecular Weight | 246.345 |
|---|
| Flash Point | 132.0±17.4 °C |
|---|
| Exact Mass | 246.161987 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 5.52 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.497 |
|---|
| InChIKey | GGQOYCFZZZEZMA-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)C(=O)CC(=O)c1ccccc1 |
|---|
Synonyms
| 1-phenyl-4-ethyl-1,3-octanedione |
| 4-ethyl-1-phenyl-1,3-octadione |
| 4-Ethyl-1-phenyl-1,3-octanedione |
| 4-ethyl-1-phenyl-octane-1,3-dione |
| 4-Aethyl-1-phenyl-octan-1,3-dion |
| 1,3-Octanedione, 4-ethyl-1-phenyl- |
| 1,3-Octanedione,4-ethyl-1-phenyl |
