Introduction：Basic information about CAS 1217437-34-7|4-Methoxyestrone-13C,d3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methoxyestrone-13C,d3 |
|---|
| CAS Number | 1217437-34-7 | Molecular Weight | 304.40 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C1813CH21D3O3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-4-(trideuteriomethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|
| Synonym | More Synonyms |
|---|
4-Methoxyestrone-13C,d3 BiologicalActivity
Chemical & Physical Properties
| Molecular Formula | C1813CH21D3O3 |
|---|
| Molecular Weight | 304.40 |
|---|
| Exact Mass | 304.19500 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.82600 |
|---|
| InChIKey | PUEXVLNGOBYUEW-VWXYHFCISA-N |
|---|
| SMILES | COc1c(O)ccc2c1CCC1C2CCC2(C)C(=O)CCC12 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 3-Hydroxy-4-methoxyestra-1,3,5(10)-trien-17-one-13C,d3 |
| 3,4-Dihydroxy-1,3,5(10)-estratrien-17-one 4-methyl-13C,d3 ether |
| 4-Methoxy Estrone-13C,d3 |
| 4-Methoxy-13C,d3-estrone |
| 4-Hydroxyestrone 4-methyl-13C,d3 ether |
| 3-Hydroxy-4-methoxy-13C,d3-1,3,5(10)-estratrien-17-one |
